154-08-5 5-fluoro-dl-tryptophan
| product Name |
5-fluoro-dl-tryptophan |
| CAS No |
154-08-5 |
| Molecular Formula |
C11H11FN2O2 |
| Molecular Weight |
222.2156 |
| InChI |
InChI=1/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| EINECS |
205-822-5 |
| Molecular Structure |
|
| Density |
1.442g/cm3 |
| Melting point |
250℃ |
| Boiling point |
450.7°C at 760 mmHg |
| Refractive index |
1.673 |
| Flash point |
226.4°C |
| Vapour Pressur |
6.54E-09mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Wang |
| Telephone |
+86-17741815008;+86-13695005683 |
| Email |
office@dudleychem.com |