13678-67-6 Difurfuryl sulfide
| product Name |
Difurfuryl sulfide |
| CAS No |
13678-67-6 |
| Synonyms |
2,2'-(thiodimethylene)-difuran; 2,2'-Thiodimethylenedifurane; 2,2'-(sulfanediyldimethanediyl)difuran; Difurfurylsulfide |
| Molecular Formula |
C10H10O2S |
| Molecular Weight |
194.2502 |
| InChI |
InChI=1/C10H10O2S/c1-3-9(11-5-1)7-13-8-10-4-2-6-12-10/h1-6H,7-8H2 |
| EINECS |
237-172-3 |
| Molecular Structure |
|
| Density |
1.195g/cm3 |
| Melting point |
30-32℃ |
| Boiling point |
269.4°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
116.7°C |
| Vapour Pressur |
0.012mmHg at 25°C |
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
David Wang |
| Telephone |
David@ji-tian.com |
| Email |
David@ji-tian.com |
| Address |
Industrial Zone Longyang Town Tengzhou City,Shandong Province,CHINA |
| Description |
| Appearance | Odor | Application | | Yellow to amber liquid or crystals | Nut Aroma, Coffee Aroma | Coffee, Sesame, Peanut, Seasonings | |
| Contact |
Lucky Liu |
| Telephone |
0086-15665710862 |
| Email |
sales@tzrunlong.com |
| Address |
No. 78, Fushan Road, Biomedical Industrial Park, Dawu Town, Tengzhou, Shandong, 277514 China |
| Description |
FEMA: 3238 CAS: 13678-67-6 |
| Contact |
Mr.Wu |
| Telephone |
+86-632-5953999;5953399;5953599 |
| Email |
sales@ruiyuanspice.com |
| Address |
No.2066, Yikang Avenue, Tengzhou City, Shandong Province, China |
| Specifications |
99%min |
| Packing |
25Kg/drum |
| Description |
Product name: Difurfuryl sulfide Cas No. : 13678-67-6 Appearance: Colorless liquid Purity: 99% Packing: 25Kg/drum Use: Flavor and fragrance intermediate |
| Contact |
Susan Xu |
| Telephone |
+86-531-82312885 15990993651 |
| Email |
yudong@yudong.com.cn |
| Address |
32 North Shanda Road,Jinan,Shandong,China |
| Contact |
Stone (Mr.) |
| Telephone |
+86-543-2240067 +86-13515431451 |
| Email |
sjc_stone@126.com |
| Address |
Lizhuan Five Road, Zouping City, Binzhou City, Shandong Province (Shenghao Third Floor) |