136-64-1 Terephthalic dihydrazide
| product Name |
Terephthalic dihydrazide |
| CAS No |
136-64-1 |
| Synonyms |
Benzene-1,4-dicarboxylic acid dihydrazide; benzene-1,4-dicarbohydrazide |
| Molecular Formula |
C8H10N4O2 |
| Molecular Weight |
194.1906 |
| InChI |
InChI=1/C8H10N4O2/c9-11-7(13)5-1-2-6(4-3-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| EINECS |
205-253-2 |
| Molecular Structure |
|
| Density |
1.344g/cm3 |
| Refractive index |
1.628 |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|