135-67-1 Phenoxazine
| product Name |
Phenoxazine |
| CAS No |
135-67-1 |
| Synonyms |
10H-phenoxazine |
| Molecular Formula |
C12H9NO |
| Molecular Weight |
183.206 |
| InChI |
InChI=1/C12H9NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| EINECS |
205-210-8 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Melting point |
154-159℃ |
| Boiling point |
318°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
122.6°C |
| Vapour Pressur |
0.000372mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |