ChemNet > CAS > 1193-22-2 4-Amino-6-hydroxypyrimidine
1193-22-2 4-Amino-6-hydroxypyrimidine
| product Name |
4-Amino-6-hydroxypyrimidine |
| CAS No |
1193-22-2 |
| Synonyms |
6-Amino-1H-pyrimidin-4-one; 4-Hydroxy-6-aminopyrimidine; 4-Oxy-6-aminopyrimidine; 4-Pyrimidinol, 6-amino-; NSC 19868; 4(1H)-Pyrimidinone, 6-amino-; 6-hydroxypyrimidin-4(3H)-one; 6-aminopyrimidin-4(1H)-one; 4-Amino-6-Hydroxy Pyrimidine; 4(3H)-Pyrimidinone, 6-amino- |
| Molecular Formula |
C4H5N3O |
| Molecular Weight |
111.102 |
| InChI |
InChI=1/C4H5N3O/c5-3-1-4(8)7-2-6-3/h1-2H,(H3,5,6,7,8) |
| EINECS |
214-771-8 |
| Molecular Structure |
|
| Density |
1.55g/cm3 |
| Boiling point |
227.5°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
91.4°C |
| Vapour Pressur |
0.0772mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |