1095-03-0 Triphenyl borate
| product Name |
Triphenyl borate |
| CAS No |
1095-03-0 |
| Synonyms |
Boric acid, triphenyl ester; 4-06-00-00769 (Beilstein Handbook Reference); AI3-60376; BRN 2056217; NSC 806; Phenyl borate; Phenyl borate, (PhO)3 B; Trifenylester kyseliny borite; Trifenylester kyseliny borite [Czech]; Triphenoxyborane; Triphenoxyboron; Boric acid (H3BO3), triphenyl ester; tris(phenoxy)borane; Orthoboric acid triphenyl ester; Boric acid triphenyl; trifenylesterkyselinyborite; Boric Acid Triphenyl Ester |
| Molecular Formula |
C18H15BO3 |
| Molecular Weight |
290.1209 |
| InChI |
InChI=1/C18H15BO3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| EINECS |
214-137-0 |
| Molecular Structure |
|
| Density |
1.134g/cm3 |
| Melting point |
98-101℃ |
| Boiling point |
343.2°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
113.4°C |
| Vapour Pressur |
0.000142mmHg at 25°C |
|
Featured China Suppliers
| Contact |
Rice Shou |
| Telephone |
+86-571-85376473 |
| Email |
riceshou@wenleechemical.com |
| Address |
Room 202, Building 8, No. 188 North Qiutao Road, Jianggan District, Hangzhou, Zhejiang, China |
| Contact |
peter |
| Telephone |
+86-21-38681880 |
| Email |
peter.xu@synmedia-chem.com |
| Address |
2/F, Block 3, East Area of Zhangjiang High Science and |