ChemNet > CAS > 67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
| Produkt-Name |
2-Chloro-N-methoxy-N-methylacetamide |
| Englischer Name |
2-Chloro-N-methoxy-N-methylacetamide; Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
| Molekulare Formel |
C4H8ClNO2 |
| Molecular Weight |
137.5648 |
| InChI |
InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
| CAS Registry Number |
67442-07-3 |
| Molecular Structure |
|
| Dichte |
1.178g/cm3 |
| Schmelzpunkt |
39-41℃ |
| Siedepunkt |
141.5°C at 760 mmHg |
| Brechungsindex |
1.442 |
| Flammpunkt |
39.4°C |
| Dampfdruck |
5.83mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|