ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
| Produkt-Name |
Triethylamine hydrobromide |
| Englischer Name |
Triethylamine hydrobromide; triethylammonium bromide |
| Molekulare Formel |
C6H15N.HBr |
| Molecular Weight |
182.10 |
| InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| CAS Registry Number |
636-70-4 |
| EINECS |
211-263-8 |
| Molecular Structure |
|
| Schmelzpunkt |
246-248℃ |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|