ChemNet > CAS > 443-33-4 2-Chloro-6-fluorobenzaldoxime
443-33-4 2-Chloro-6-fluorobenzaldoxime
| Produkt-Name |
2-Chloro-6-fluorobenzaldoxime |
| Englischer Name |
2-Chloro-6-fluorobenzaldoxime; 2-Chloro-6-fluorobenzaldehyde oxime |
| Molekulare Formel |
C7H5ClFNO |
| Molecular Weight |
173.5721 |
| InChI |
InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
| CAS Registry Number |
443-33-4 |
| EINECS |
207-135-6 |
| Molecular Structure |
|
| Dichte |
1.32g/cm3 |
| Schmelzpunkt |
133℃ |
| Siedepunkt |
238°C at 760 mmHg |
| Brechungsindex |
1.533 |
| Flammpunkt |
97.8°C |
| Dampfdruck |
0.0237mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|