ChemNet > CAS > 42287-90-1 3-(3-Bromophenyl)propionic acid
42287-90-1 3-(3-Bromophenyl)propionic acid
| Produkt-Name |
3-(3-Bromophenyl)propionic acid |
| Englischer Name |
3-(3-Bromophenyl)propionic acid; 3-(3-bromophenyl)propanoic acid |
| Molekulare Formel |
C9H9BrO2 |
| Molecular Weight |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12) |
| CAS Registry Number |
42287-90-1 |
| Molecular Structure |
|
| Dichte |
1.531g/cm3 |
| Schmelzpunkt |
72-76℃ |
| Siedepunkt |
336.3°C at 760 mmHg |
| Brechungsindex |
1.578 |
| Flammpunkt |
157.2°C |
| Dampfdruck |
4.44E-05mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|