3586-14-9 3-Phenoxytoluene
| Produkt-Name |
3-Phenoxytoluene |
| Englischer Name |
3-Phenoxytoluene; Phenyl m-tolyl ether; 3-Methyldiphenyl ether; 1-methyl-3-phenoxybenzene |
| Molekulare Formel |
C13H12O |
| Molecular Weight |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10H,1H3 |
| CAS Registry Number |
3586-14-9 |
| EINECS |
222-716-4 |
| Molecular Structure |
|
| Dichte |
1.045g/cm3 |
| Siedepunkt |
269.1°C at 760 mmHg |
| Brechungsindex |
1.566 |
| Flammpunkt |
110.8°C |
| Dampfdruck |
0.0122mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|