ChemNet > CAS > 1737-62-8 4-Fluorophenoxyacetic acid hydrazide
1737-62-8 4-Fluorophenoxyacetic acid hydrazide
| Produkt-Name |
4-Fluorophenoxyacetic acid hydrazide |
| Englischer Name |
4-Fluorophenoxyacetic acid hydrazide; AKOS B015229; AKOS AU36-M58; 2-(4-FLUOROPHENOXY)ACETIC ACID HYDRAZIDE; 2-(4-FLUOROPHENOXY)ACETOHYDRAZIDE |
| Molekulare Formel |
C8H9FN2O2 |
| Molecular Weight |
184.1677 |
| InChI |
InChI=1/C8H9FN2O2/c9-6-1-3-7(4-2-6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| CAS Registry Number |
1737-62-8 |
| Molecular Structure |
|
| Dichte |
1.281g/cm3 |
| Siedepunkt |
408.8°C at 760 mmHg |
| Brechungsindex |
1.534 |
| Flammpunkt |
201°C |
| Dampfdruck |
6.84E-07mmHg at 25°C |
| Gefahrensymbole |
Xi:;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|