1608-51-1 4-Fluorochalcone
| Produkt-Name |
4-Fluorochalcone |
| Englischer Name |
4-Fluorochalcone; 1-Phenyl-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylideneacetophenone; 3-(4-fluorophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-fluorophenyl)-1-phenylprop-2-en-1-one |
| Molekulare Formel |
C15H11FO |
| Molecular Weight |
226.2456 |
| InChI |
InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| CAS Registry Number |
1608-51-1 |
| Molecular Structure |
|
| Dichte |
1.166g/cm3 |
| Schmelzpunkt |
84℃ |
| Siedepunkt |
345.9°C at 760 mmHg |
| Brechungsindex |
1.608 |
| Flammpunkt |
157.3°C |
| Dampfdruck |
5.97E-05mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|