135-01-3 1,2-diethylbenzene
| Produkt-Name |
1,2-diethylbenzene |
| Englischer Name |
1,2-diethylbenzene; Diethylbenzene; o-Diethylbenzene |
| Molekulare Formel |
C10H14 |
| Molecular Weight |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
135-01-3 |
| EINECS |
205-170-1 |
| Molecular Structure |
|
| Dichte |
0.865g/cm3 |
| Siedepunkt |
183.5°C at 760 mmHg |
| Brechungsindex |
1.496 |
| Flammpunkt |
49.4°C |
| Dampfdruck |
1.05mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|