ChemNet > CAS > 1155-64-2 N-epsilon-Carbobenzyloxy-L-lysine
1155-64-2 N-epsilon-Carbobenzyloxy-L-lysine
| Produkt-Name |
N-epsilon-Carbobenzyloxy-L-lysine |
| Englischer Name |
N-epsilon-Carbobenzyloxy-L-lysine; N-epsilon-CBZ-L-Lysine; Z-(e)-Lysine; N-6-carbobenzyloxy-L-lysine; N-?-CBZ-L-Lysine N-?-Carbobenzyloxy-L-lysine; N6-benzyloxycarbonyl-L-lysine; N(5)-Benzyloxycarbonyl-L-lysine; H-Lys(Z)-OH; BenzyloxycarbonylLlysine; Lys(z)
; N~2~-[(benzyloxy)carbonyl]-L-lysine; (2S)-2-ammonio-6-{[(benzyloxy)carbonyl]amino}hexanoate; N6-Cbz-L-lysine; Nepsilon-Benzyloxycarbonyl-L-Lysine |
| Molekulare Formel |
C14H20N2O4 |
| Molecular Weight |
280.3196 |
| InChI |
InChI=1/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| CAS Registry Number |
1155-64-2 |
| EINECS |
214-585-7 |
| Molecular Structure |
|
| Dichte |
1.206g/cm3 |
| Schmelzpunkt |
259℃ (dec.) |
| Siedepunkt |
499.6°C at 760 mmHg |
| Brechungsindex |
1.55 |
| Flammpunkt |
255.9°C |
| Dampfdruck |
8.43E-11mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|