2694-54-4 Triallyl Trimellitate
| název vyrobku |
Triallyl Trimellitate |
| Anglicky název |
Triallyl Trimellitate; 1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
| Molekulární vzorec |
C18H18O6 |
| Molekulová hmotnost |
330.3319 |
| InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
| Registra?ní ?íslo CAS |
2694-54-4 |
| EINECS |
220-264-2 |
| Molekulární struktura |
|
| Hustota |
1.149g/cm3 |
| Bod varu |
438.1°C at 760 mmHg |
| Index lomu |
1.528 |
| Bod vzplanutí |
191.3°C |
| Tlak par |
7.07E-08mmHg at 25°C |
| Riziko Codes |
R36/38:Irritating to eyes and skin.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|