133-11-9 Phenyl 4-aminosalicylate
| název vyrobku |
Phenyl 4-aminosalicylate |
| Anglicky název |
Phenyl 4-aminosalicylate; 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate;
; phenyl 4-amino-2-hydroxybenzoate |
| Molekulární vzorec |
C13H11NO3 |
| Molekulová hmotnost |
229.2313 |
| InChI |
InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
| Registra?ní ?íslo CAS |
133-11-9 |
| EINECS |
205-092-8 |
| Molekulární struktura |
|
| Hustota |
1.32g/cm3 |
| Bod tání |
147-152℃ |
| Bod varu |
406.4°C at 760 mmHg |
| Index lomu |
1.659 |
| Bod vzplanutí |
199.6°C |
| Tlak par |
3.48E-07mmHg at 25°C |
| Symbol? nebezpe?nosti |
Xi:Irritant;
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpe?nostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|