| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
839-90-7 |
| EC NO: |
212-660-9 |
| Molecular Formula: |
C9H16N3O6 |
| Molecular Weight: |
262.23984 |
| Specification: |
|
| InChI: |
InChI=1/C9H16N3O6/c13-4-1-7-8(16)10(2-5-14)12(18)11(3-6-15)9(7)17/h7,13-15H,1-6H2 |
| Packing: |
In PVC plastic bag, polypropylene weaving bag exterior. |
Product description:
Formula: C9H15O6N3M.W.: 261.22Description: White crystallized powder or granular
|
| Uses: |
To produce intermediate of multiple organic chemical products, raw material of synthetic resin, additive, modifier, adhesive and raw material ofcoatings, especially to be as raw material of heat-proof, insulated materials and to produce heat-proof, corrsi |
| Synonyms: |
tris(2-hydroxyethyl)-1,3,5-triazinetrione;tris(2-hydroxyethyl) isocyanurate;tris(2-hydroxyethyl) isoyanurate;THEIC;1,3,5-tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione;1,3,5-tris(2-hydroxyethyl)-2-oxo-1,2$l4,3-triazacyclohexane-4,6-dione;Tris(2-hydroxyethyl)Isocyanurate; |
| Molecular Structure: |
 |