| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
24634-61-5 |
| EC NO: |
246-376-1 |
| Molecular Formula: |
C6H7KO2 |
| Molecular Weight: |
150.2169 |
| Specification: |
|
| InChI: |
InChI=1/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2-,5-4-; |
| Packing: |
25kg cartons(13MT/FCL). |
Product description:
White powder or granular,very easily soluble in water,also soluble in alcohol.
|
| Uses: |
Used as preservative in food industry,is effective to mold and other mushroom which likes air.The preservative effect decreases white PH value increases.The most suitable scope is PH 5-6.Potassium sorbate has no poisonous or side effect.Mainly used in soy |
| Synonyms: |
2,4-Hexadienoic acid, potassium salt, (E,E)-;potassium (E,E)-hexa-2,4-dienoate;(E,E)-hexadienoic acid, potassium salt;Potassium sarbate;2,4-potassium hexadienoic acid;2,4-Hexadienoic acid potassium salt;2,4-Potassium Sorbate;potassium (2E,4E)-hexa-2,4-dienoate;potassium (2Z,4Z)-hexa-2,4-dienoate; |
| Molecular Structure: |
 |