| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
123-31-9 |
| EC NO: |
204-617-8 |
| Molecular Formula: |
C6H6O2 |
| Molecular Weight: |
110.11244 |
| Specification: |
|
| InChI: |
InChI=1/C9H6O4/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11/h1-4,10-11H |
| Packing: |
25kgs net bag(1x20'FCL=19mts without pallet) |
Product description:
Molecular Formula: C6H6O2CAS Number: 123-31-9Description: Vapor Pressure: 0.00067 mmHg at 25℃Vapor Density: 3.8 (air=1) bp: 287℃at 760 mm Hgmp:172℃Density: 1.33 g/ml at 25℃Fp: 165℃SpecificationAssay: 99.0-101.0%Melting point: 171-175℃Solubility: Up to standard Residue on ignition: 0.05% max Heavy metal (Pb): 0.002% max Iron (Fe): 0.002% max
|
| Synonyms: |
1,4-Benzenediol;Quinol;Hydroxyquinone;1,4-Dihydroxybenzene;benzene-1,4-diol;6,7-dihydroxy-2H-chromen-2-one;1,4-Dihydroxy benzene;1,4-Dihydroxy-benzol; |
| Molecular Structure: |
 |