ChemNet > CAS > 2396-85-2 ????? ????? -2-????????? ? 219-259-8
2396-85-2 ????? ????? -2-????????? ? 219-259-8
| ??? ?????? |
????? ????? -2-????????? ? 219-259-8 |
| ????? ???????? |
????? ???? -2-??????. ??????? (2E) - ?????? -2-enoate ? |
| ????? ??????????? |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| ?????? ???????? |
C9H16O2 |
| ????? ??????? ??????? |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| ?????????? ???????? ??????? |
2396-85-2 |
| ???????? ????????? ??? |
219-259-8 |
| ???? ?????? |
|
| ????? |
0.896g/cm3 |
| ???? ??????? |
194.6°C at 760 mmHg |
| ????? ???????? |
1.436 |
| ???? ?????? |
82.8°C |
| ??? ?????? |
0.437mmHg at 25°C |
| ??? ????????? |
R36/38:Irritating to eyes and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|