2396-85-2 methyltrans-2-octenoaat
| Naam product |
methyltrans-2-octenoaat |
| Synoniemen |
219-259-8; Methyl oct-2-enoaat; methyl(2E)-oct-2-enoaat |
| Engelse naam |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| MF |
C9H16O2 |
| Molecuulgewicht |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| CAS-nummer |
2396-85-2 |
| EINECS |
219-259-8 |
| Moleculaire Structuur |
|
| Dichtheid |
0.896g/cm3 |
| Kookpunt |
194.6°C at 760 mmHg |
| Brekingsindex |
1.436 |
| Vlampunt |
82.8°C |
| Dampdruk |
0.437mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|