ChemNet > CAS > 9017-21-4 Poli(vinyltoluene), isomer campuran
9017-21-4 Poli(vinyltoluene), isomer campuran
| Nama produk |
Poli(vinyltoluene), isomer campuran |
| Sinonim |
;p olyvinyltoluene; Vinyl toluene resin |
| Nama Inggeris |
Poly(vinyltoluene), mixed isomers; polyvinyltoluene; Vinyl toluene resin |
| MF |
(C9H10)x |
| Berat Molekul |
118.178 |
| InChI |
InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
| CAS NO |
9017-21-4 |
| Struktur Molekul |
|
| Titik didih |
100℃ |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|