| ???? |
??? ???????? |
| ?? |
?????? ((HO)C (O) SC (S) (OH)), OC, OC'-? ?? ????; AI3-19742; ?? ???? ?? ????; NSC 403191; ????, ??-, O-?? ???????? ??? ???????; ???, ??-, O-?? ???????? ??? ???????; ??, ???-, O-?? ???????? ??? ?????, O-?? ????(8CI); ??? ???????? ((OH)C(O)SC(S)(OH)); ??????((HO)C(O)SC(S)(OH)), ??? ????; ??????, ??? ????; O,O-??? ????????? |
| ?? ?? |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| ??? |
C6H10O3S2 |
| ??? |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| cas?? |
3278-35-1 |
| EC?? |
221-911-1 |
| ?? ?? |
|
| ?? |
1.242g/cm3 |
| ??? |
236°C at 760 mmHg |
| ?? ?? |
1.534 |
| ??? |
96.5°C |
| ??? |
0.0487mmHg at 25°C |
|