ChemNet > CAS > 485-33-6 DL-Laudanosoline ??????????? ??? ???????
485-33-6 DL-Laudanosoline ??????????? ??? ???????
| ??? ????? |
DL-Laudanosoline ??????????? ??? ??????? |
| ?????? |
D L-6?7-dimethoxy-1- ((3?4-dimethoxyphenyl) ????) -2-methylisoquinoline hydrobromide trihydrate? ??? ?????? ??????????? DL-laudanosine? 1- (3?4-?? ???????? ?????) -2-????-1?2?3?4-???????????????????-6?7-???? ???????????? ??? ??????? (1S) -1- (3?4-?? ???????? ?????) -6?7-?? ????????-2-????-1?2?3?4-??????????????????????? (1R) -1- (3?4-?? ???????? ?????) -6?7-?? ????????-2-????-1?2?3?4-??????????????????????? |
| ??? ??????? |
DL-Laudanosoline hydrobromide trihydrate; DL-6,7-dimethoxy-1-((3,4-dimethoxyphenyl)methyl)-2-methylisoquinoline hydrobromide trihydrate; DL-laudanosine hydrobromide trihydrate; 1-(3,4-dihydroxybenzyl)-2-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol hydrobromide trihydrate; (1S)-1-(3,4-dihydroxybenzyl)-6,7-dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium; (1R)-1-(3,4-dihydroxybenzyl)-6,7-dihydroxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium |
| ????? ???????? |
C17H20NO4 |
| ??? ??????? |
302.3445 |
| InChI |
InChI=1/C17H19NO4/c1-18-5-4-11-8-16(21)17(22)9-12(11)13(18)6-10-2-3-14(19)15(20)7-10/h2-3,7-9,13,19-22H,4-6H2,1H3/p+1/t13-/m1/s1 |
| ????? ?????? |
485-33-6 |
| ????? ??????? ??????? |
207-613-4 |
| ?????? ??????? |
|
| ???? ??? |
232-234℃ |
| ???? ????? |
548°C at 760 mmHg |
| ???? ?????? |
323°C |
| ???? ???? |
1.28E-12mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|