| ?????? ?? ??? |
??????? ??????????????? |
| ????????? |
??????????????? ???? ((???) ?? (?) ???? (??) (???)), ???, ???'-??????? ?????; ???3-19742; ???? ????????? ???? ???????; ?????? 403191; Xanthic ????, ????-, O-???? thiocarbonate ?? ??? anhydrosulfide; Xanthic ????, ????-, O-???? thiolcarbonate ?? ??? anhydrosulfide; ????????? ????, ??????-, ?-???? ????????????? ?? ??? ????????????????, ?-???? ????? (8CI); ??????? ??????????????? ((???) ?? (?) ???? (??) (???)); ??????????????? ???? ((???) ?? (?) ???? (??) (???)), ??????? ?????; ??????????????? ????, ??????? ?????; ??, ?-??????? ?????????????????? |
| ???????? ??? |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| ????? ???????? |
C6H10O3S2 |
| ?????? ??? |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| ??? ??????? ?????? |
3278-35-1 |
| EINECS |
221-911-1 |
| ????? ?????? |
|
| ????? |
1.242g/cm3 |
| ????? ?? ??? |
236°C at 760 mmHg |
| ??????? ??????? |
1.534 |
| ????? ??????? |
96.5°C |
| ????? ?? ???? |
0.0487mmHg at 25°C |
|