ChemNet > CAS > 2396-85-2 ?????? ??????-2-?????????
2396-85-2 ?????? ??????-2-?????????
| ?????? ?? ??? |
?????? ??????-2-????????? |
| ????????? |
; 219-259-8; ?????? ????-2-?????; ?????? (2E) -oct-2-enoate |
| ???????? ??? |
methyl trans-2-octenoate; 219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| ????? ???????? |
C9H16O2 |
| ?????? ??? |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| ??? ??????? ?????? |
2396-85-2 |
| EINECS |
219-259-8 |
| ????? ?????? |
|
| ????? |
0.896g/cm3 |
| ????? ?? ??? |
194.6°C at 760 mmHg |
| ??????? ??????? |
1.436 |
| ????? ??????? |
82.8°C |
| ????? ?? ???? |
0.437mmHg at 25°C |
| ???? ?? ??? |
R36/38:Irritating to eyes and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|