| ?????? ?? ??? |
????????? |
| ????????? |
; ???????? ?? ????? ?? ??? ???????????? ??????; ????? ?? ???????? ?? ??? ???????????? ??????; ????????????, ???????? ?? ?????; ????????????, ????????, ?? ?????; ????????; ??????; ????????; ?????; ????????; ??????; ???????; ????????, ??????, ?? ?????; ????????, ???????????? ?? ?????; ??????; ??????; ?????? ????; ??????-????; ?????; ??????; ????????? ????; ???????; ????; ??????; ????????; ?????????, ??- (4-????????????????) -, ???????3,7-??????????-1,3,7-???????????-1 ??-???????-2,6-????? ?? 5- (2-??????????????) -5- (2-?????????) -2,4,6 (1 ??, 3 ??, 5 ??) -?????????????????? ?? ???; 5-???? -5-?????????-??????????????????????? -2,4,6-???????; ??- (4-????????????????) ?????????; 1,3,7-????????????????? -2,6-????? |
| ???????? ??? |
Fioricet; Acetaminophen mixture with butalbital and caffeine; Acetaminophen mixture with caffeine and butalbital; Acetaminophen, butalbital and caffeine; Acetaminophen, butalbital, and caffeine; Alagesic; Amaphen; Americet; Anolor; Anoquan; Arcet; Butace; Butalbital, APAP, and caffeine; Butalbital, acetaminophen and caffeine; Endolor; Esgic; Esgic Plus; Esgic-Plus; Ezol; Femcet; Medigesic Plus; Pacaps; Repan; Tencet; Zebutal; Acetamide, N-(4-hydroxyphenyl)-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and 5-(2-methylpropyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione; 5-allyl-5-isobutyl-hexahydropyrimidine-2,4,6-trione; N-(4-hydroxyphenyl)acetamide; 1,3,7-trimethylpurine-2,6-dione |
| ????? ???????? |
C27H35N7O7 |
| ?????? ??? |
569.6095 |
| InChI |
InChI=1/C11H16N2O3.C8H10N4O2.C8H9NO2/c1-4-5-11(6-7(2)3)8(14)12-10(16)13-9(11)15;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-6(10)9-7-2-4-8(11)5-3-7/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16);4H,1-3H3;2-5,11H,1H3,(H,9,10) |
| ??? ??????? ?????? |
122018-95-5 |
| ????? ?????? |
|
| ????? ?? ??? |
805°C at 760 mmHg |
| ????? ??????? |
440.7°C |
| ????? ?? ???? |
5.84E-27mmHg at 25°C |
|