| ?? ????? |
?????? ??????????? |
| ?????? |
????? ???????????? ((HO)C(O)SC(S)(OH)), OC,OC'-?????? ????; AI3-19742; ???? xanthogen ???? formate; ???"? 403191; ????? ??????, ????, ????????????? ?? O-???? ?????????; ????? ??????, ????-, ????????????? ?? O-???? ????-??????; ????? ???????, ?????, ????????????? ?? O-???? ?????????, O-???? ???? (8CI); ?????? ??????????? ((OH)C(O)SC(S)(OH)); ????? ???????????? ((HO)C(O)SC(S)(OH)), ?????? ????; ????? ????????????, ???? ??????; O,O-diethyl dithiodicarbonate |
| ?? ????? |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| ????????? ??????? |
C6H10O3S2 |
| ???? ???????? |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| ???? CAS |
3278-35-1 |
| EINECS |
221-911-1 |
| ???? ???????? |
|
| ?????? |
1.242g/cm3 |
| ????? ????? |
236°C at 760 mmHg |
| ???? ????? |
1.534 |
| ????? ???? |
96.5°C |
| ??? ???? |
0.0487mmHg at 25°C |
|