ChemNet > CAS > 935-44-4 1-fenil-1-siklopropanakarbonitril
935-44-4 1-fenil-1-siklopropanakarbonitril
| Nama produk |
1-fenil-1-siklopropanakarbonitril |
| Sinonim |
1-Fenilsiklopropanakarbonitril |
| Nama bahasa Inggris |
1-Phenyl-1-cyclopropanecarbonitrile;1-Phenylcyclopropanecarbonitrile |
| MF |
C10H9N |
| Berat Molekul |
143.1852 |
| InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| CAS NO |
935-44-4 |
| EINECS |
213-304-5 |
| Struktur Molekul |
|
| Kepadatan |
1.09g/cm3 |
| Titik didih |
238.5°C at 760 mmHg |
| Indeks bias |
1.571 |
| Titik nyala |
99°C |
| Tekanan uap |
0.0422mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|