497-36-9 endo-(±)-Norborneol?
| Nom |
endo-(±)-Norborneol? |
| Synonymes |
; endo-(?-2-Norbornanol?;( 1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol? |
| Nom anglais |
endo-(±)-Norborneol; endo-(?-2-Norbornanol; (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| Formule moléculaire |
C7H12O |
| Poids Moléculaire |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| Numéro de registre CAS |
497-36-9 |
| EINECS |
207-844-0 |
| Structure moléculaire |
|
| Densité |
1.098g/cm3 |
| Point de fusion |
148-154℃ |
| Point d'ébullition |
176.499°C at 760 mmHg |
| Indice de réfraction |
1.537 |
| Point d'éclair |
74.376°C |
| Pression de vapeur |
0.332mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|