99-96-7 4-Hydroxybenzoic acid
| product Name |
4-Hydroxybenzoic acid |
| CAS No |
99-96-7 |
| Synonyms |
P-OXYBENZOIC ACID; para hydroxy benzoic acid; P-hydroxybenzoic acid; 4-hydroxybenzoate; Para-Hydroxybenzoic Acid |
| Molecular Formula |
C7H6O3 |
| Molecular Weight |
137.1133 |
| InChI |
InChI=1/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)/p-1 |
| EINECS |
202-804-9 |
| Molecular Structure |
|
| Melting point |
214-217℃ |
| Boiling point |
336.2°C at 760 mmHg |
| Flash point |
171.3°C |
| Water solubility |
5 g/L (20℃) |
| Vapour Pressur |
4.48E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr.Guo |
| Telephone |
+86-570-3080488;3082488;3080881 |
| Email |
sx@shengxiaochemical.com |
| Address |
Shengxiao Building, Block C, Building 30, Hehua East District, Quzhou, Zhejiang, China |
| Packing |
25kg plastic woven bags lined with PE bag(18MT/FCL). |
| Description |
White crystlalline powder,easily soluble in hot water and alcohol,soluble in diethyl ether and acetone,slightly soluble in benzol,insoluble in carbon bisulfide.Specific gravity 1.46,melting point 213??C-217??C. |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Mrs. Wang |
| Telephone |
+86-15726167122 |
| Email |
sales@zsscm.com.cn |
| Address |
No.316-6,3rd Floor,New Material Trading Center,Tianqiao Jinan250031,Shandong,China |
| Telephone |
+86-27-83831778 |
| Email |
zhangxu@chinaorganic.com |
| Address |
10 Gongnong Road ,Qiaokou District ,Wuhan,China |
| Specifications |
Molecular Formula:C7H6O3 |
| Description |
Molecular Weight: 138.12 |
| Contact |
qzwr |
| Telephone |
86-570-3888197 3888298 |
| Email |
qzwryh@qzweirong.com |
| Address |
No.9,Chuncheng Road,High-tech Zone,Quzhou Zhejiang,China |