87206-44-8 D(+)-Methioninol
| product Name |
D(+)-Methioninol |
| CAS No |
87206-44-8 |
| Synonyms |
(R)-2-Amino-4-methylmercapto-1-butanol; D-Methioninol; (2R)-1-hydroxy-4-(methylsulfanyl)butan-2-aminium; (2R)-2-amino-4-(methylsulfanyl)butan-1-ol |
| Molecular Formula |
C5H13NOS |
| Molecular Weight |
135.2278 |
| InChI |
InChI=1/C5H13NOS/c1-8-3-2-5(6)4-7/h5,7H,2-4,6H2,1H3/t5-/m1/s1 |
| Molecular Structure |
|
| Density |
1.068g/cm3 |
| Melting point |
31-36℃ |
| Boiling point |
270.2°C at 760 mmHg |
| Refractive index |
1.516 |
| Flash point |
117.2°C |
| Vapour Pressur |
0.000913mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|