865-49-6 Chloroform-d
| product Name |
Chloroform-d |
| CAS No |
865-49-6 |
| Synonyms |
Chloroform-d+1% TMs (v/v); chloroform-D 99.8 atom % D*contains 1% tms; Chloroformdisotopicpuritytetramethylsilane; Chloroform-d + 0.05% TMS (v/v); Chloroformdiosotopicpurity; Chloroform D1; trichloro(~2~H)methane |
| Molecular Formula |
CDCl3 |
| Molecular Weight |
120.3838 |
| InChI |
InChI=1/CHCl3/c2-1(3)4/h1H/i1D |
| EINECS |
212-742-4 |
| Molecular Structure |
|
| Density |
1.512g/cm3 |
| Melting point |
-64℃ |
| Boiling point |
61.2°C at 760 mmHg |
| Refractive index |
1.445 |
| Vapour Pressur |
200mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R40:Possible risks of irreversible effects.;
R48/20/22:Harmful : danger of serious damage to health by prolonged exposure through inhalation and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Zhang |
| Telephone |
+86-21-58956006 |
| Email |
info@abotto.com |
| Address |
Room 303 Building 5 Hengyue Life Square Lane 1111 Miaojing Road Pudong China |