6836-19-7 7-methoxy-1-tetralone
| product Name |
7-methoxy-1-tetralone |
| CAS No |
6836-19-7;6386-19-7 |
| Synonyms |
7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 7-methoxyl-1-tetralone; 7-methoxy-3,4-dihydronaphthalen-1(2H)-one; 3,4-Dihydro-7-methoxy-1(2H)-naphthalenone; 7-Methoxy-1-Tetralone |
| Molecular Formula |
C11H12O2 |
| Molecular Weight |
176.2118 |
| InChI |
InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3 |
| EINECS |
229-916-0 |
| Molecular Structure |
|
| Density |
1.124g/cm3 |
| Melting point |
59-63℃ |
| Boiling point |
312.3°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
145.8°C |
| Vapour Pressur |
0.000535mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Ms Zhao |
| Telephone |
+86-576-85698929 |
| Email |
yu.zhao108@gmail.com |
| Address |
Yanjiang Chemical Zone, Linhai City, Zhejiang, China |
| Contact |
Ms Ye |
| Telephone |
+86-519-82765788;82765761;82761788 |
| Email |
guml@depeichem.com;shiyf@depeichem.com |
| Address |
No. 88, Changshan Shuixi Village, Xuebu Town, Jintan District, Changzhou City, Jiangsu Province, China |
| Telephone |
+86-25-83247442/443/445/446/447 |
| Email |
sales@levachem.com |
| Address |
2112 SuNing Universal Mansion, 188 Guangzhou Road, Nanjing 210024, China |
| Telephone |
+86-571-85803833;56766020 |
| Email |
info@unipharma-chem.com |
| Address |
R.1109, Deep Blue Square Building, No. 203, Zhaohui Rd., Hangzhou China |
| Telephone |
86-571-81956191 81956192 |
| Email |
Info@sinocochem.com |
| Address |
425 Ruiqi Mansion Moganshan Road , Hangzhou 310011 China. |