ChemNet > CAS > 6358-64-1 4-chloro-2,5-dimethoxyaniline
6358-64-1 4-chloro-2,5-dimethoxyaniline
| product Name |
4-chloro-2,5-dimethoxyaniline |
| CAS No |
6358-64-1 |
| Synonyms |
4-Chloro-2,5-Dimethoxy Benzenamine; 2-Amino-5-chlorohydroquinone dimethyl ether; 2,5-Dimethoxy-4-Chloro-Aniline; 2,5-Dimethoxy-4-Chloro Aniline; 2,5-Dimethoxy-4-Chloroaniline |
| Molecular Formula |
C8H10ClNO2 |
| Molecular Weight |
187.6235 |
| InChI |
InChI=1/C8H10ClNO2/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4H,10H2,1-2H3 |
| EINECS |
228-782-0 |
| Molecular Structure |
|
| Density |
1.237g/cm3 |
| Melting point |
118-120℃ |
| Boiling point |
310.2°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
141.4°C |
| Vapour Pressur |
0.000611mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|
Featured China Suppliers
| Telephone |
+86-21-62744350 62598819 |
| Email |
marketing@kelcochem.com |
| Address |
Rm 601, Tianshan Manshion, No. 30, Tian Shan Road,Shanghai, 200336, China. |
| Specifications |
99% min |
| Packing |
25kg 50kg drum or bag |
| Description |
What is the chemical of 2,5-Dimethoxy-4-Chloro anil-ine ? Appearance: Grayish white to brown powder?? Assay:99%min by HPLC?? IR Identity: conform to standard?? HNMR?? conform to standard?? carbon spectrum: conform to standard?? Water by K. F.:0.5% max or as per the customer??s request?? Loss on drying:0.5% max. or as per the customer??s request?? =============================================================================== 2,5-Dimethoxy-4-Chloroanil-ine Main Uses: It is primarily used as a dye intermediate for synthesizing various azo dyes and organic pigments. It is employed in the synthesis of Catechol AS-LC, which is then used to prepare Red Base R (Pigment Red 146). Additionally, it is used in the synthesis of Catechol AS-IRG for the production of Pigment Yellow 83. It also serves as an organic pigment intermediate, a pharmaceutical intermediate, and an organic building block. =============================================================================== Synthesis Route: 4-C... |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |