632-22-4 1,1,3,3-Tetramethylurea
| product Name |
1,1,3,3-Tetramethylurea |
| CAS No |
632-22-4 |
| Synonyms |
Tetramethylurea |
| Molecular Formula |
C5H12N2O |
| Molecular Weight |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| EINECS |
211-173-9 |
| Molecular Structure |
|
| Density |
0.9879 |
| Melting point |
-1℃ |
| Boiling point |
174-178℃ |
| Refractive index |
1.4496-1.4516 |
| Flash point |
65℃ |
| Water solubility |
miscible |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Specifications |
99.9% |
| Packing |
200kgs/drum |
| Contact |
Mr. Edward Zhang |
| Telephone |
+86-23-67896333 |
| Email |
info@changfengchem.com |
| Address |
30th Floor, Longhu Ziduxingzuo Building, 1st Branch,YuSong Rd., Yubei District, Chongqing, China |
| Telephone |
+86-23-89018534 |
| Email |
info@justit-cq.com |
| Address |
9/F,Foreign Trade Building,65,North Jianxin Road,Jiangbei District,Chongqing,China |
| Telephone |
+86-21-68769091 |
| Email |
info@tritonchemtech.com |
| Address |
Room 717, 7/F, Information Tower, 1403 Minsheng Road, Shanghai, 200135, China |
| Telephone |
+86-23-67910421;67074306;67074306 |
| Email |
trustlong@263.net |
| Address |
3-6-2, No.1, Xinglong Road, Longxi Town, Yubei Dist.,Chongqing,China |