621-91-0 1,4-dibenzyloxybenzene
| product Name |
1,4-dibenzyloxybenzene |
| CAS No |
621-91-0 |
| Synonyms |
Dibenzyloxybenzene,98%; quinol dibenzyl ether; 1,4-Bis(phenylmethoxy)benzene; Hydroquinone dibenzyl ether; 1,4-bis(benzyloxy)benzene |
| Molecular Formula |
C20H18O2 |
| Molecular Weight |
290.3557 |
| InChI |
InChI=1/C20H18O2/c1-3-7-17(8-4-1)15-21-19-11-13-20(14-12-19)22-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
| EINECS |
210-714-6 |
| Molecular Structure |
|
| Density |
1.121g/cm3 |
| Boiling point |
441.7°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
173.4°C |
| Vapour Pressur |
1.39E-07mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Maria shen/Emma/Jenny/Wendy |
| Telephone |
+86-570-3039321;3891001;3039361 |
| Email |
kyjx@kaiyuan-chemical.com,shenchen3751321@126.com |
| Address |
18# Huayang Road,Quzhou High-tech Industrial Park, Zhejiang, China |