ChemNet > CAS > 611-92-7 1,3-dimethyl-1,3-diphenylurea
611-92-7 1,3-dimethyl-1,3-diphenylurea
| product Name |
1,3-dimethyl-1,3-diphenylurea |
| CAS No |
611-92-7 |
| Synonyms |
N,N-Dimethyl-N,N-diphenylurea; centralite-II; Methyl Centralite; N,N'-Dimethyldiphenylurea |
| Molecular Formula |
C15H16N2O |
| Molecular Weight |
240.3003 |
| InChI |
InChI=1/C15H16N2O/c1-16(13-9-5-3-6-10-13)15(18)17(2)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| EINECS |
210-283-4 |
| Molecular Structure |
|
| Density |
1.161g/cm3 |
| Melting point |
120-122℃ |
| Boiling point |
350°C at 760 mmHg |
| Refractive index |
1.639 |
| Flash point |
142.6°C |
| Water solubility |
soluble in alcohol, ether and benzene, insoluble in water. |
| Vapour Pressur |
4.53E-05mmHg at 25°C |
|
Featured China Suppliers
| Contact |
Fan Chunxing |
| Telephone |
+86-510-85881805;+86-510-85881876 |
| Email |
sales1@wxhmchem.com |
| Address |
No.1406, Building 3, Calxon Fortune Center, Financial 3rd Street, Jingkai District, Wuxi, P. R. of China |