591-78-6 2-Hexanone
| product Name |
2-Hexanone |
| CAS No |
591-78-6 |
| Synonyms |
n-Butyl methyl ketone; MBK; Methyl n-butyl ketone; Methyl butyl ketone; Butyl methyl ketone; Methyl buthyl ketone; MNBK |
| Molecular Formula |
C6H12O |
| Molecular Weight |
100.16 |
| InChI |
InChI=1/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3 |
| EINECS |
209-731-1 |
| Molecular Structure |
|
| Density |
0.81 |
| Melting point |
-57℃ |
| Boiling point |
127℃ |
| Refractive index |
1.3995-1.4015 |
| Flash point |
23℃ |
| Water solubility |
2 g/100 mL (20℃) |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R10:;
R48/23:;
R62:;
R67:;
|
| Safety Description |
S36/37:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Dr.Wang HX;Mr.Zhang Yi |
| Telephone |
+86-510-87823598;87479185 |
| Email |
zhg@zhgchem.com |
| Address |
Yongning Road, Yixiang Economic Development Zone, Jiangsu Province, China. |
| Contact |
Lucky Liu |
| Telephone |
0086-15665710862 |
| Email |
sales@tzrunlong.com |
| Address |
No. 78, Fushan Road, Biomedical Industrial Park, Dawu Town, Tengzhou, Shandong, 277514 China |
| Specifications |
99% min |
| Packing |
25kg??50kg 200kg |
| Description |
What is the chemical of 2-Hexanone ? Appearance: Colorless liquid with an odor similar to acetone ; Assay??99%min by GC ; IR Identity: conform to standard ; HNMR?? conform to standard ; carbon spectrum: conform to standard ; Water by K. F.:0.5% max or as per the customer??s request ; Loss on drying:0.5% max. or as per the customer??s request ; boiling point: 127?C127.8 ??C; ============================================================================= Usage: 2-Hexanone is mainly used as a solvent and organic synthesis intermediate. Specific applications include: As an industrial solvent, it is used to dissolve resins, oils, etc. As an intermediate in chemical synthesis, it is used to prepare other organic compounds. Special purpose: Extracting ferric chloride from hydrochloric acid solution ============================================================================= Synthesis route: 2-Hexanone can be synthesized through various methods, one of which is a classic method: Co heating... |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |