526-78-3 2,3-Dibromosuccinic acid
| product Name |
2,3-Dibromosuccinic acid |
| CAS No |
526-78-3;608-35-5;608-36-6 |
| Synonyms |
Dibromosuccinicacid; 2,3-Dibromosucinic Acid; 2,3-Dibromo Dibutyric Acid; meso-2,3-Dibromosuccinic acid; (2R,3S)-2,3-dibromobutanedioic acid; (2R,3S)-2,3-dibromobutanedioate |
| Molecular Formula |
C4H2Br2O4 |
| Molecular Weight |
273.8654 |
| InChI |
InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| EINECS |
208-396-9 |
| Molecular Structure |
|
| Melting point |
255-260℃ |
| Boiling point |
262.4°C at 760 mmHg |
| Flash point |
112.5°C |
| Water solubility |
20 g/L (17℃) |
| Vapour Pressur |
0.00323mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
+86-571-88086639 |
| Email |
info@star-chemicals.com |
| Address |
No. 810 Qinggong Building, No. 8 Wensan Road, Hangzhou, China |
| Telephone |
+86-563-7086515;13965658882 |
| Email |
sales@lh-biochem.com |
| Address |
49 Xiangshanjiaodi, Langxi County, Anhui Province, China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Specifications |
white crystalline powder |
| Packing |
25kg/drum |
| Description |
assay:98% mp :274 ??C (subl.) |
| Contact |
Yolanda Lixia Yang |
| Telephone |
0755-27670086 |
| Email |
yolanda@vtolo.com |
| Address |
No. 203, Haibinghuayuan, Baoan, Shenzhen, China |