359-13-7 2,2-difluoroethanol
| product Name |
2,2-difluoroethanol |
| CAS No |
359-13-7 |
| Synonyms |
Difluoroethanol; chloroacetyl fluoride |
| Molecular Formula |
C2H2ClFO |
| Molecular Weight |
96.4881 |
| InChI |
InChI=1/C2H2ClFO/c3-1-2(4)5/h1H2 |
| Molecular Structure |
|
| Density |
1.277g/cm3 |
| Boiling point |
109.2°C at 760 mmHg |
| Refractive index |
1.352 |
| Flash point |
19.8°C |
| Vapour Pressur |
25.1mmHg at 25°C |
| Risk Codes |
R11:Highly flammable.;
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Contact |
DAVY SHI |
| Telephone |
+86-573-83102518;83100413 |
| Email |
info@xiangyang-chem.com |
| Address |
Buyun, Daqiao town, JiaXing City, Nanhu district, Zhejiang China |
| Telephone |
+86-571 89189769 86-15168342188 |
| Email |
sales@hetechem.comtech@hetechem.com |
| Address |
Room309, Electronic Commerce Building, No.323 yingbin Road, LinPing, HangZhou |
| Contact |
Scarlett |
| Telephone |
+86-575-82399190;+86-13819637081 |
| Email |
sales06@xieshichem.com |
| Address |
No.16, Fine Chemical Park, Weiwu Road, Hangzhou Bay, Shanguu City, Zhejiang Province, China |
| Contact |
Karl |
| Telephone |
+86-571-85395792 +13867466880 |
| Email |
info@orchid-chem.com |
| Address |
R1812, 607, North Zhongshan Road, Hangzhou, Zhejiang, China |
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |