ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
| product Name |
chlorocarbonylsulfenyl chloride |
| CAS No |
2757-23-5 |
| Synonyms |
Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
| Molecular Formula |
CCl2OS |
| Molecular Weight |
130.9811 |
| InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
| EINECS |
220-415-2 |
| Molecular Structure |
|
| Density |
1.66g/cm3 |
| Boiling point |
98°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
53.7°C |
| Vapour Pressur |
40.7mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Contact |
General Liu;Manager Hao |
| Telephone |
+86-13851696588;+86-18105162895;+86-25-57252098 |
| Email |
njlys@njhakko.js.bnet.cn,njchm@njhakko.js.bnet.cn |
| Address |
Gongye North Road, Baima Town, Lishui District, Nanjing, China |