ChemNet > CAS > 27194-74-7 lauric acid, monoester with propane-1,2-diol
27194-74-7 lauric acid, monoester with propane-1,2-diol
| product Name |
lauric acid, monoester with propane-1,2-diol |
| CAS No |
27194-74-7;142-55-2 |
| Synonyms |
BPML; 2-hydroxypropyl laurate; 2-hydroxypropyl dodecanoate; 1-hydroxypropan-2-yl dodecanoate |
| Molecular Formula |
C15H30O3 |
| Molecular Weight |
258.3969 |
| InChI |
InChI=1/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)18-14(2)13-16/h14,16H,3-13H2,1-2H3 |
| EINECS |
248-315-4 |
| Molecular Structure |
|
| Density |
0.931g/cm3 |
| Boiling point |
362.5°C at 760 mmHg |
| Refractive index |
1.451 |
| Flash point |
139.3°C |
| Vapour Pressur |
1.01E-06mmHg at 25°C |
|