ChemNet > CAS > 26227-73-6 N-(4-Methoxybenzylidene)-4-butylaniline
26227-73-6 N-(4-Methoxybenzylidene)-4-butylaniline
| product Name |
N-(4-Methoxybenzylidene)-4-butylaniline |
| CAS No |
26227-73-6 |
| Synonyms |
4-Butyl-N-(4-methoxybenzylidene)aniline; 4-butyl-N-[(E)-(4-methoxyphenyl)methylidene]aniline; Mbba |
| Molecular Formula |
C18H21NO |
| Molecular Weight |
267.3654 |
| InChI |
InChI=1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+ |
| EINECS |
247-527-4 |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Boiling point |
403.9°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
160°C |
| Vapour Pressur |
2.3E-06mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|