ChemNet > CAS > 167678-46-8 3-Acetoxy-2-Methylbenzoyl Chloride
167678-46-8 3-Acetoxy-2-Methylbenzoyl Chloride
| product Name |
3-Acetoxy-2-Methylbenzoyl Chloride |
| CAS No |
167678-46-8 |
| Synonyms |
3-Acetoxy-o-toluoyl chloride; 2-methyl-3-acetoxybenzoic chloride; 3-acetoxy-2-methylbenzoic chloride; 3-(chlorocarbonyl)-2-methylphenyl acetate; 2-methyl-3-acetoxy benzoic chloride |
| Molecular Formula |
C10H9ClO3 |
| Molecular Weight |
212.6297 |
| InChI |
InChI=1/C10H9ClO3/c1-6-8(10(11)13)4-3-5-9(6)14-7(2)12/h3-5H,1-2H3 |
| EINECS |
433-690-0 |
| Molecular Structure |
|
| Density |
1.252g/cm3 |
| Boiling point |
295.6°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
123.6°C |
| Vapour Pressur |
0.00151mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Contact |
Mr.Wu |
| Telephone |
+86-792-5686966 |
| Email |
ky1@keyuanchem.com |
| Address |
Jishan Industrial Zone,Pengze County,Jiangxi Province. |