150-13-0 4-Aminobenzoic acid
| product Name |
4-Aminobenzoic acid |
| CAS No |
150-13-0 |
| Synonyms |
p-Aminobenzoic acid; PABA; H-4-Abz-OH; P-amino benzoic acid; p-Amino Benzonic Acid; 4-aminobenzoate; 4-Aminobenzonic acid; Acid 4-aminobenzoico; Aminobenzoic acid, 4- |
| Molecular Formula |
C7H7NO2 |
| Molecular Weight |
137.13808 |
| InChI |
InChI=1/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1 |
| EINECS |
205-753-0 |
| Molecular Structure |
|
| Melting point |
186-189℃ |
| Boiling point |
339.9°C at 760 mmHg |
| Flash point |
159.4°C |
| Water solubility |
4.7 g/L (20℃) |
| Vapour Pressur |
3.45E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-575-84815521??84817945 |
| Email |
lhfc@lhfc.sina.net |
| Address |
Beisan spur track, Shaoxing Binhai Industrial Zone, Shaoxing, Zhejiang, P.R. China 312073 |
| Specifications |
Assay:99% min |
| Description |
Colorless crystals,easily soluble in hot water,diethyl ether,ethyl acetate,alcohol and glacial acetic acid,slightly soluble in cold water and benzol,insoluble in petroleum ether. |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Telephone |
0086-519-83138042;83137042;83137041;0086-519-83139028(english);83131668(english) |
| Email |
info@sunlightchem.com |
| Address |
JiuliStreet, Benniu Town Changzhou, Jiangsu Province, China. |
| Contact |
Gord Chu |
| Telephone |
+86-513-85559168 |
| Email |
Gord@ntacf.com |
| Address |
No.968 Jiangshan Road Nantong Economic and Technological Development Zone, Jiangsu, China |
| Telephone |
+86-21-63766500 63780299 |
| Email |
Luo@shluckychem.com |
| Address |
Rm.1010,No.1300 lujiabang Road Shanghai 200011 P.R.China |