132-20-7 pheniramine maleate
| product Name |
pheniramine maleate |
| CAS No |
132-20-7 |
| Synonyms |
pheniramine hydrogen maleate; N,N-dimethyl-3-phenyl-3-pyridin-2-ylpropan-1-amine (2Z)-but-2-enedioate; 2-[3-(dimethylammonio)-1-phenylpropyl]pyridinium (2E)-but-2-enedioate; 2-[3-(dimethylammonio)-1-phenylpropyl]pyridinium propanedioate |
| Molecular Formula |
C19H24N2O4 |
| Molecular Weight |
344.4049 |
| InChI |
InChI=1/C16H20N2.C3H4O4/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16;4-2(5)1-3(6)7/h3-10,12,15H,11,13H2,1-2H3;1H2,(H,4,5)(H,6,7) |
| EINECS |
205-051-4 |
| Molecular Structure |
|
| Melting point |
104-108℃ |
| Boiling point |
348.3°C at 760 mmHg |
| Flash point |
164.5°C |
| Water solubility |
>=1 g/100 mL at 24℃ |
| Vapour Pressur |
5.07E-05mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S36:;
|
|
Featured China Suppliers
| Specifications |
assay:99.9 |
| Packing |
Cardboard barrels |
| Description |
The Malay acid non nirah sensitive content 98.0 (%) English name Pheniramine MaleateCAS: 132-20-7 molecular formula C16H20N2? C4H4O4 molecular weight 356.5 packing specification: content p 20kg 99.9% net 10 - a barrel. |
| Contact |
ivy shao |
| Telephone |
86-373-2513 858 |
| Email |
sales@tianfengchem.com;swz@tianfengchem.com |
| Address |
East of Huanyu Avenue, Xinxiang, Henan, China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |