123-54-6 2,4-Pentanedione
| product Name |
2,4-Pentanedione |
| CAS No |
123-54-6 |
| Synonyms |
Acetylacetone; pentane-2,4-dione; pentane-2,3-dione; (3E)-4-hydroxypent-3-en-2-one; (3Z)-4-hydroxypent-3-en-2-one; Acetyl Acetone; 2,4-Pentane dione; 2,4-Pentandione |
| Molecular Formula |
C5H8O2 |
| Molecular Weight |
100.1158 |
| InChI |
InChI=1/C5H8O2/c1-4(6)3-5(2)7/h3,6H,1-2H3/b4-3- |
| EINECS |
204-634-0 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Melting point |
-23℃ |
| Boiling point |
187.6°C at 760 mmHg |
| Refractive index |
1.45 |
| Flash point |
71.9°C |
| Water solubility |
16 g/100 mL (20℃) |
| Vapour Pressur |
0.174mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R10:;
R22:;
|
| Safety Description |
S21:;
S23:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-572-3752149;13906724548;13706721705 |
| Email |
shen4548@tbchem.com |
| Address |
Xia'ang industrial zone, Huzhou, Zhejiang, China |
| Packing |
Product description:Colorless or light yellow, easy flowing transparent liquid. |
| Description |
CAS: 123-54-6 MW:100.12EC NO.: 204-634-0MF: C5H8O2Packing:Product description:Colorless or light yellow, easy flowing transparent liquid. Use:It has wide applications. 1. Mainly used in the synthesis of pharmacy and intermediates; 2. Used in the synthesizing of veterinary medicine and feed additives; 3. Used as the additive for solvent of cellulose acetate, for gasoline and lubricating oil and binding material for electroplating. |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Mrs. Wang |
| Telephone |
+86-15726167122 |
| Email |
sales@zsscm.com.cn |
| Address |
No.316-6,3rd Floor,New Material Trading Center,Tianqiao Jinan250031,Shandong,China |
| Contact |
qzwr |
| Telephone |
86-570-3888197 3888298 |
| Email |
qzwryh@qzweirong.com |
| Address |
No.9,Chuncheng Road,High-tech Zone,Quzhou Zhejiang,China |
| Contact |
Joanna:+86-13256654883 |
| Telephone |
Lisa:+86-13954100668 Rebecca.Yuan:+86-13953131820 |
| Email |
yuan@chemwww.com Joanna@chemwww.com |
| Address |
20th floor, building 9, Xintiandi square, No. 61, Gongye South Road, Jinan area, (Shandong) pilot Free Trade Zone??China |