122-00-9 4'-Methylacetophenone
| product Name |
4'-Methylacetophenone |
| CAS No |
122-00-9 |
| Synonyms |
4-Acetyltoluene; 4-Methylacetophenone; 4-Methylacetophenone (p-); 1-Acetyl-4-methylbenzene; 1-Methyl-4-acetylbenzen; methyl p-tolyl ketone; 4-Methyl Acetophenone; Photoinitiator-4MAP; 1-(4-methylphenyl)ethanone; p-Methylacetophenone; 1-(p-tolyl)ethanone |
| Molecular Formula |
C9H10O |
| Molecular Weight |
134.1751 |
| InChI |
InChI=1/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6H,1-2H3 |
| EINECS |
204-514-8 |
| Molecular Structure |
|
| Density |
0.977g/cm3 |
| Melting point |
22-24℃ |
| Boiling point |
214°C at 760 mmHg |
| Refractive index |
1.51 |
| Flash point |
80.6°C |
| Water solubility |
0.37 g/L (15℃) |
| Vapour Pressur |
0.159mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S23:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Chang Cheng; Yan Zhenyu |
| Telephone |
+86-25-58392388-600 |
| Email |
yanliuxin@sinohighchem.com |
| Address |
No. 51 Chongfu Road,Nanjing Chemical Industrial Park,Nanjing City 210047,China |
| Contact |
Adriano |
| Telephone |
+86-571-88937695;88937835 |
| Email |
sales@chemspon.com |
| Address |
38 Xianyuan Road, Hangzhou,Zhejiang, China |
| Specifications |
99% |
| Telephone |
+86-573-86611193 86863220 |
| Email |
sales@zjjh-finechem.com |
| Address |
Haihe Avenue Daqiao New District Haiyan,Zhejiang,China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Specifications |
98%min Colorless or light yellow liquid |
| Packing |
200kg/drum |
| Description |
Product name:4-Methylacetophenone Cas No. :122-00-9 Purity:98%min Appearance:Colorless or light yellow liquid Packing:200kg/drum Usage:intermediates of spices and herbicides and in organic synthesis |
| Contact |
Susan Xu |
| Telephone |
+86-531-82312885 15990993651 |
| Email |
yudong@yudong.com.cn |
| Address |
32 North Shanda Road,Jinan,Shandong,China |